C21H29F3N2O2 — CID 145315931
tert-butyl (3aR,5R,6aS)-3a-methyl-5-[[4-(trifluoromethyl)phenyl]methylamino]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 145315931) has the molecular formula C21H29F3N2O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is tert-butyl (3aR,5R,6aS)-3a-methyl-5-[[4-(trifluoromethyl)phenyl]methylamino]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aR,5R,6aS)-3a-methyl-5-[[4-(trifluoromethyl)phenyl]methylamino]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 145315931 |
| Molecular Formula | C21H29F3N2O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | tert-butyl (3aR,5R,6aS)-3a-methyl-5-[[4-(trifluoromethyl)phenyl]methylamino]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H](NCc3ccc(C(F)(F)F)cc3)C[C@@]2(C)C1 |
| InChI | InChI=1S/C21H29F3N2O2/c1-19(2,3)28-18(27)26-12-16-9-17(10-20(16,4)13-26)25-11-14-5-7-15(8-6-14)21(22,23)24/h5-8,16-17,25H,9-13H2,1-4H3/t16-,17-,20+/m1/s1 |
| InChIKey | RIBGRPRIUPZBOY-HLIPFELVSA-N |
| XLogP | 4.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |