C21H27F3N2O5 — CID 126720690
5-O-tert-butyl 2-O-[[4-(trifluoromethoxy)phenyl]methyl] (3aS,6aS)-3a-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-2,5-dicarboxylate (PubChem CID 126720690) has the molecular formula C21H27F3N2O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is 5-O-tert-butyl 2-O-[[4-(trifluoromethoxy)phenyl]methyl] (3aS,6aS)-3a-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-2,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 2-O-[[4-(trifluoromethoxy)phenyl]methyl] (3aS,6aS)-3a-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 126720690 |
| Molecular Formula | C21H27F3N2O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 5-O-tert-butyl 2-O-[[4-(trifluoromethoxy)phenyl]methyl] (3aS,6aS)-3a-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(C(=O)OCc3ccc(OC(F)(F)F)cc3)C[C@@]2(C)C1 |
| InChI | InChI=1S/C21H27F3N2O5/c1-19(2,3)31-18(28)26-10-15-9-25(12-20(15,4)13-26)17(27)29-11-14-5-7-16(8-6-14)30-21(22,23)24/h5-8,15H,9-13H2,1-4H3/t15-,20-/m0/s1 |
| InChIKey | YVFCCGRDFMZLFQ-YWZLYKJASA-N |
| XLogP | 4.41 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |