C17H23F3N2O3 — CID 90755810
[4-(trifluoromethoxy)phenyl]methyl 4-butylpiperazine-1-carboxylate (PubChem CID 90755810) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl]methyl 4-butylpiperazine-1-carboxylate.
| Compound Name | [4-(trifluoromethoxy)phenyl]methyl 4-butylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 90755810 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl]methyl 4-butylpiperazine-1-carboxylate |
| SMILES | CCCCN1CCN(C(=O)OCc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-2-3-8-21-9-11-22(12-10-21)16(23)24-13-14-4-6-15(7-5-14)25-17(18,19)20/h4-7H,2-3,8-13H2,1H3 |
| InChIKey | IZCAKXHIHSPQNR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |