C18H25F3N2O2 — CID 91201426
[2-(trifluoromethyl)phenyl]methyl 4-pentylpiperazine-1-carboxylate (PubChem CID 91201426) has the molecular formula C18H25F3N2O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl]methyl 4-pentylpiperazine-1-carboxylate.
| Compound Name | [2-(trifluoromethyl)phenyl]methyl 4-pentylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 91201426 |
| Molecular Formula | C18H25F3N2O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methyl 4-pentylpiperazine-1-carboxylate |
| SMILES | CCCCCN1CCN(C(=O)OCc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H25F3N2O2/c1-2-3-6-9-22-10-12-23(13-11-22)17(24)25-14-15-7-4-5-8-16(15)18(19,20)21/h4-5,7-8H,2-3,6,9-14H2,1H3 |
| InChIKey | JVIWCYRIBFVJJS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|