C13H15F3O2 — CID 102335909
[2-(trifluoromethyl)phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 102335909) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [2-(trifluoromethyl)phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102335909 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3O2/c1-12(2,3)11(17)18-8-9-6-4-5-7-10(9)13(14,15)16/h4-7H,8H2,1-3H3 |
| InChIKey | VHNVQIBYRYYOIQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |