C24H16F6O4 — CID 91754080
bis[[2-(trifluoromethyl)phenyl]methyl] benzene-1,2-dicarboxylate (PubChem CID 91754080) has the molecular formula C24H16F6O4 and a molecular weight of 482.38 g/mol. Its IUPAC name is bis[[2-(trifluoromethyl)phenyl]methyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[[2-(trifluoromethyl)phenyl]methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91754080 |
| Molecular Formula | C24H16F6O4 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | bis[[2-(trifluoromethyl)phenyl]methyl] benzene-1,2-dicarboxylate |
| SMILES | O=C(OCc1ccccc1C(F)(F)F)c1ccccc1C(=O)OCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H16F6O4/c25-23(26,27)19-11-5-1-7-15(19)13-33-21(31)17-9-3-4-10-18(17)22(32)34-14-16-8-2-6-12-20(16)24(28,29)30/h1-12H,13-14H2 |
| InChIKey | HQZDVFVHGMRAOZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |