About [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate
[2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 7226410) has the molecular formula C16H11F3N2O2
and a molecular weight of 320.27 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate |
| PubChem CID | 7226410 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1C(F)(F)F)c1cn2ccccc2n1 |
| InChI | InChI=1S/C16H11F3N2O2/c17-16(18,19)12-6-2-1-5-11(12)10-23-15(22)13-9-21-8-4-3-7-14(21)20-13/h1-9H,10H2 |
| InChIKey | MLMTXYHUZJZAMY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate?
The IUPAC name of [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate (CID 7226410) is [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate.
What is the SMILES notation for [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate?
The canonical SMILES for [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate is O=C(OCc1ccccc1C(F)(F)F)c1cn2ccccc2n1.
What is the InChIKey of [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate?
The InChIKey is MLMTXYHUZJZAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3N2O2/c17-16(18,19)12-6-2-1-5-11(12)10-23-15(22)13-9-21-8-4-3-7-14(21)20-13/h1-9H,10H2.
What are the key properties of [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate?
[2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate has a molecular weight of 320.27 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(trifluoromethyl)phenyl]methyl imidazo[1,2-a]pyridine-2-carboxylate is sourced from PubChem (CID 7226410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).