C9H8N2O — CID 11194486
1-imidazo[1,2-a]pyridin-2-ylethanone (PubChem CID 11194486) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-2-ylethanone.
| Compound Name | 1-imidazo[1,2-a]pyridin-2-ylethanone |
|---|---|
| PubChem CID | 11194486 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-2-ylethanone |
| SMILES | CC(=O)c1cn2ccccc2n1 |
| InChI | InChI=1S/C9H8N2O/c1-7(12)8-6-11-5-3-2-4-9(11)10-8/h2-6H,1H3 |
| InChIKey | GCYDHNHJLGOKSB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |