C10H6Cl3F3O2 — CID 91726282
2,2,2-trichloroethyl 2-(trifluoromethyl)benzoate (PubChem CID 91726282) has the molecular formula C10H6Cl3F3O2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-(trifluoromethyl)benzoate.
| Compound Name | 2,2,2-trichloroethyl 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 91726282 |
| Molecular Formula | C10H6Cl3F3O2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | 2,2,2-trichloroethyl 2-(trifluoromethyl)benzoate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H6Cl3F3O2/c11-9(12,13)5-18-8(17)6-3-1-2-4-7(6)10(14,15)16/h1-4H,5H2 |
| InChIKey | NPORQAZKKVHHCT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|