About chloro hypochlorite;copper;2-(trifluoromethyl)benzamide
chloro hypochlorite;copper;2-(trifluoromethyl)benzamide (PubChem CID 159662780) has the molecular formula C8H6Cl2CuF3NO2
and a molecular weight of 339.59 g/mol. Its IUPAC name is chloro hypochlorite;copper;2-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | chloro hypochlorite;copper;2-(trifluoromethyl)benzamide |
| PubChem CID | 159662780 |
| Molecular Formula | C8H6Cl2CuF3NO2 |
| Molecular Weight | 339.59 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | chloro hypochlorite;copper;2-(trifluoromethyl)benzamide |
| SMILES | ClOCl.NC(=O)c1ccccc1C(F)(F)F.[Cu] |
| InChI | InChI=1S/C8H6F3NO.Cl2O.Cu/c9-8(10,11)6-4-2-1-3-5(6)7(12)13;1-3-2;/h1-4H,(H2,12,13);; |
| InChIKey | MTAGNHSKTKQZMV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chloro hypochlorite;copper;2-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro hypochlorite;copper;2-(trifluoromethyl)benzamide?
The IUPAC name of chloro hypochlorite;copper;2-(trifluoromethyl)benzamide (CID 159662780) is chloro hypochlorite;copper;2-(trifluoromethyl)benzamide.
What is the SMILES notation for chloro hypochlorite;copper;2-(trifluoromethyl)benzamide?
The canonical SMILES for chloro hypochlorite;copper;2-(trifluoromethyl)benzamide is ClOCl.NC(=O)c1ccccc1C(F)(F)F.[Cu].
What is the InChIKey of chloro hypochlorite;copper;2-(trifluoromethyl)benzamide?
The InChIKey is MTAGNHSKTKQZMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO.Cl2O.Cu/c9-8(10,11)6-4-2-1-3-5(6)7(12)13;1-3-2;/h1-4H,(H2,12,13);;.
What are the key properties of chloro hypochlorite;copper;2-(trifluoromethyl)benzamide?
chloro hypochlorite;copper;2-(trifluoromethyl)benzamide has a molecular weight of 339.59 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro hypochlorite;copper;2-(trifluoromethyl)benzamide is sourced from PubChem (CID 159662780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).