C10H5F6NO3 — CID 142933924
[2-carbamoyl-6-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 142933924) has the molecular formula C10H5F6NO3 and a molecular weight of 301.14 g/mol. Its IUPAC name is [2-carbamoyl-6-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-carbamoyl-6-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142933924 |
| Molecular Formula | C10H5F6NO3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | [2-carbamoyl-6-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | NC(=O)c1cccc(C(F)(F)F)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H5F6NO3/c11-9(12,13)5-3-1-2-4(7(17)18)6(5)20-8(19)10(14,15)16/h1-3H,(H2,17,18) |
| InChIKey | NINCVOHQJWRLAW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|