C9H3F7O2 — CID 91695328
[2-fluoro-3-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 91695328) has the molecular formula C9H3F7O2 and a molecular weight of 276.11 g/mol. Its IUPAC name is [2-fluoro-3-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-fluoro-3-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91695328 |
| Molecular Formula | C9H3F7O2 |
| Molecular Weight | 276.11 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | [2-fluoro-3-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cccc(C(F)(F)F)c1F)C(F)(F)F |
| InChI | InChI=1S/C9H3F7O2/c10-6-4(8(11,12)13)2-1-3-5(6)18-7(17)9(14,15)16/h1-3H |
| InChIKey | HDPXSFHMQHLLSP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|