C8H3F5O3 — CID 145086138
(2,3-difluoro-4-hydroxyphenyl) 2,2,2-trifluoroacetate (PubChem CID 145086138) has the molecular formula C8H3F5O3 and a molecular weight of 242.10 g/mol. Its IUPAC name is (2,3-difluoro-4-hydroxyphenyl) 2,2,2-trifluoroacetate.
| Compound Name | (2,3-difluoro-4-hydroxyphenyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 145086138 |
| Molecular Formula | C8H3F5O3 |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | (2,3-difluoro-4-hydroxyphenyl) 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccc(O)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C8H3F5O3/c9-5-3(14)1-2-4(6(5)10)16-7(15)8(11,12)13/h1-2,14H |
| InChIKey | HBRWCVOUSFYTOJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|