C12H7F3N2O3 — CID 140563087
(3-hydroxy-2-pyrimidin-5-ylphenyl) 2,2,2-trifluoroacetate (PubChem CID 140563087) has the molecular formula C12H7F3N2O3 and a molecular weight of 284.19 g/mol. Its IUPAC name is (3-hydroxy-2-pyrimidin-5-ylphenyl) 2,2,2-trifluoroacetate.
| Compound Name | (3-hydroxy-2-pyrimidin-5-ylphenyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140563087 |
| Molecular Formula | C12H7F3N2O3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | (3-hydroxy-2-pyrimidin-5-ylphenyl) 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cccc(O)c1-c1cncnc1)C(F)(F)F |
| InChI | InChI=1S/C12H7F3N2O3/c13-12(14,15)11(19)20-9-3-1-2-8(18)10(9)7-4-16-6-17-5-7/h1-6,18H |
| InChIKey | BWVMSIBZQSYVFC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|