C14H5F9O6 — CID 91694735
[3-(2,2,2-trifluoroacetyl)oxy-2-[1-(2,2,2-trifluoroacetyl)oxyethenyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 91694735) has the molecular formula C14H5F9O6 and a molecular weight of 440.17 g/mol. Its IUPAC name is [3-(2,2,2-trifluoroacetyl)oxy-2-[1-(2,2,2-trifluoroacetyl)oxyethenyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-(2,2,2-trifluoroacetyl)oxy-2-[1-(2,2,2-trifluoroacetyl)oxyethenyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91694735 |
| Molecular Formula | C14H5F9O6 |
| Molecular Weight | 440.17 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | [3-(2,2,2-trifluoroacetyl)oxy-2-[1-(2,2,2-trifluoroacetyl)oxyethenyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | C=C(OC(=O)C(F)(F)F)c1c(OC(=O)C(F)(F)F)cccc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H5F9O6/c1-5(27-9(24)12(15,16)17)8-6(28-10(25)13(18,19)20)3-2-4-7(8)29-11(26)14(21,22)23/h2-4H,1H2 |
| InChIKey | GFUPHIAUKMLRBW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|