C17H5F15O6 — CID 91710806
[3-(2,2,3,3,3-pentafluoropropanoyloxy)-2-[1-(2,2,3,3,3-pentafluoropropanoyloxy)ethenyl]phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91710806) has the molecular formula C17H5F15O6 and a molecular weight of 590.19 g/mol. Its IUPAC name is [3-(2,2,3,3,3-pentafluoropropanoyloxy)-2-[1-(2,2,3,3,3-pentafluoropropanoyloxy)ethenyl]phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [3-(2,2,3,3,3-pentafluoropropanoyloxy)-2-[1-(2,2,3,3,3-pentafluoropropanoyloxy)ethenyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91710806 |
| Molecular Formula | C17H5F15O6 |
| Molecular Weight | 590.19 g/mol |
| Exact Mass | 589.98 |
| IUPAC Name | [3-(2,2,3,3,3-pentafluoropropanoyloxy)-2-[1-(2,2,3,3,3-pentafluoropropanoyloxy)ethenyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | C=C(OC(=O)C(F)(F)C(F)(F)F)c1c(OC(=O)C(F)(F)C(F)(F)F)cccc1OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H5F15O6/c1-5(36-9(33)12(18,19)15(24,25)26)8-6(37-10(34)13(20,21)16(27,28)29)3-2-4-7(8)38-11(35)14(22,23)17(30,31)32/h2-4H,1H2 |
| InChIKey | UMWNDXWQARNWGK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.19 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|