C16H6F15NO5 — CID 91710808
[5-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]-2-methoxyphenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91710808) has the molecular formula C16H6F15NO5 and a molecular weight of 577.20 g/mol. Its IUPAC name is [5-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]-2-methoxyphenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [5-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]-2-methoxyphenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91710808 |
| Molecular Formula | C16H6F15NO5 |
| Molecular Weight | 577.20 g/mol |
| Exact Mass | 577.00 |
| IUPAC Name | [5-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]-2-methoxyphenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | COc1ccc(N(C(=O)C(F)(F)C(F)(F)F)C(=O)C(F)(F)C(F)(F)F)cc1OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H6F15NO5/c1-36-6-3-2-5(4-7(6)37-10(35)13(21,22)16(29,30)31)32(8(33)11(17,18)14(23,24)25)9(34)12(19,20)15(26,27)28/h2-4H,1H3 |
| InChIKey | FBRQMXRLZNMRDL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.20 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|