C12H9F5O4 — CID 91741492
(2-acetyl-5-methoxyphenyl) 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91741492) has the molecular formula C12H9F5O4 and a molecular weight of 312.19 g/mol. Its IUPAC name is (2-acetyl-5-methoxyphenyl) 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | (2-acetyl-5-methoxyphenyl) 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91741492 |
| Molecular Formula | C12H9F5O4 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (2-acetyl-5-methoxyphenyl) 2,2,3,3,3-pentafluoropropanoate |
| SMILES | COc1ccc(C(C)=O)c(OC(=O)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F5O4/c1-6(18)8-4-3-7(20-2)5-9(8)21-10(19)11(13,14)12(15,16)17/h3-5H,1-2H3 |
| InChIKey | GDOUHPJDCMCTMM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|