C14H6F10O5 — CID 91745219
[3-acetyl-4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91745219) has the molecular formula C14H6F10O5 and a molecular weight of 444.18 g/mol. Its IUPAC name is [3-acetyl-4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [3-acetyl-4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91745219 |
| Molecular Formula | C14H6F10O5 |
| Molecular Weight | 444.18 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | [3-acetyl-4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CC(=O)c1cc(OC(=O)C(F)(F)C(F)(F)F)ccc1OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H6F10O5/c1-5(25)7-4-6(28-9(26)11(15,16)13(19,20)21)2-3-8(7)29-10(27)12(17,18)14(22,23)24/h2-4H,1H3 |
| InChIKey | ZZCYTJPWVMTCAP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|