C18H12F14O4 — CID 91695236
[3-tert-butyl-4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91695236) has the molecular formula C18H12F14O4 and a molecular weight of 558.26 g/mol. Its IUPAC name is [3-tert-butyl-4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [3-tert-butyl-4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91695236 |
| Molecular Formula | C18H12F14O4 |
| Molecular Weight | 558.26 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | [3-tert-butyl-4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(C)(C)c1cc(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)ccc1OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H12F14O4/c1-12(2,3)8-6-7(35-10(33)13(19,20)15(23,24)17(27,28)29)4-5-9(8)36-11(34)14(21,22)16(25,26)18(30,31)32/h4-6H,1-3H3 |
| InChIKey | ULXVPEHJKBRQQK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.26 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|