C17H19F7O4Si — CID 91744562
[tert-butyl(dimethyl)silyl] 2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)benzoate (PubChem CID 91744562) has the molecular formula C17H19F7O4Si and a molecular weight of 448.41 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)benzoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)benzoate |
|---|---|
| PubChem CID | 91744562 |
| Molecular Formula | C17H19F7O4Si |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)c1ccccc1OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H19F7O4Si/c1-14(2,3)29(4,5)28-12(25)10-8-6-7-9-11(10)27-13(26)15(18,19)16(20,21)17(22,23)24/h6-9H,1-5H3 |
| InChIKey | UNRMEYLLZDIQQR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|