C18H11F7O4 — CID 91710385
[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl] 4-methylbenzoate (PubChem CID 91710385) has the molecular formula C18H11F7O4 and a molecular weight of 424.27 g/mol. Its IUPAC name is [2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl] 4-methylbenzoate.
| Compound Name | [2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 91710385 |
| Molecular Formula | C18H11F7O4 |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | [2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccccc2OC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H11F7O4/c1-10-6-8-11(9-7-10)14(26)28-12-4-2-3-5-13(12)29-15(27)16(19,20)17(21,22)18(23,24)25/h2-9H,1H3 |
| InChIKey | RJXXYJWHQYKZSF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|