C15H13F7O4 — CID 91748919
2-methylpropyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)benzoate (PubChem CID 91748919) has the molecular formula C15H13F7O4 and a molecular weight of 390.25 g/mol. Its IUPAC name is 2-methylpropyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)benzoate.
| Compound Name | 2-methylpropyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)benzoate |
|---|---|
| PubChem CID | 91748919 |
| Molecular Formula | C15H13F7O4 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-methylpropyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)benzoate |
| SMILES | CC(C)COC(=O)c1ccc(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F7O4/c1-8(2)7-25-11(23)9-3-5-10(6-4-9)26-12(24)13(16,17)14(18,19)15(20,21)22/h3-6,8H,7H2,1-2H3 |
| InChIKey | CSTRTTJRMJWTFJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|