C11H7F7O2S — CID 91716679
(4-methylsulfanylphenyl) 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91716679) has the molecular formula C11H7F7O2S and a molecular weight of 336.23 g/mol. Its IUPAC name is (4-methylsulfanylphenyl) 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (4-methylsulfanylphenyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91716679 |
| Molecular Formula | C11H7F7O2S |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (4-methylsulfanylphenyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CSc1ccc(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H7F7O2S/c1-21-7-4-2-6(3-5-7)20-8(19)9(12,13)10(14,15)11(16,17)18/h2-5H,1H3 |
| InChIKey | AFYUWVLSDHLJDG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|