C18H18F2O5S — CID 20657914
(4-methylsulfanylphenyl) 2,2-difluoro-2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 20657914) has the molecular formula C18H18F2O5S and a molecular weight of 384.40 g/mol. Its IUPAC name is (4-methylsulfanylphenyl) 2,2-difluoro-2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (4-methylsulfanylphenyl) 2,2-difluoro-2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 20657914 |
| Molecular Formula | C18H18F2O5S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (4-methylsulfanylphenyl) 2,2-difluoro-2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(C(F)(F)C(=O)Oc2ccc(SC)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18F2O5S/c1-22-14-9-11(10-15(23-2)16(14)24-3)18(19,20)17(21)25-12-5-7-13(26-4)8-6-12/h5-10H,1-4H3 |
| InChIKey | GENWKKHCPXIYKW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|