phenyl 2,2-difluoro-2-methylsulfanylacetate

C9H8F2O2S — CID 101183893

IUPACphenyl 2,2-difluoro-2-methylsulfanylacetate
SMILESCSC(F)(F)C(=O)Oc1ccccc1
InChIInChI=1S/C9H8F2O2S/c1-14-9(10,11)8(12)13-7-5-3-2-4-6-7/h2-6H,1H3
InChIKeyXNAVSMIWKKIKNR-UHFFFAOYSA-N
MW218.22 g/mol
LogP2.55
Rot. Bonds3

About phenyl 2,2-difluoro-2-methylsulfanylacetate

phenyl 2,2-difluoro-2-methylsulfanylacetate (PubChem CID 101183893) has the molecular formula C9H8F2O2S and a molecular weight of 218.22 g/mol. Its IUPAC name is phenyl 2,2-difluoro-2-methylsulfanylacetate.

Molecular Properties

Compound Namephenyl 2,2-difluoro-2-methylsulfanylacetate
PubChem CID101183893
Molecular FormulaC9H8F2O2S
Molecular Weight218.22 g/mol
Exact Mass218.02
IUPAC Namephenyl 2,2-difluoro-2-methylsulfanylacetate
SMILESCSC(F)(F)C(=O)Oc1ccccc1
InChIInChI=1S/C9H8F2O2S/c1-14-9(10,11)8(12)13-7-5-3-2-4-6-7/h2-6H,1H3
InChIKeyXNAVSMIWKKIKNR-UHFFFAOYSA-N
XLogP2.55
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.22
LogP ≤ 52.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze phenyl 2,2-difluoro-2-methylsulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenyl 2,2-difluoro-2-methylsulfanylacetate?
The IUPAC name of phenyl 2,2-difluoro-2-methylsulfanylacetate (CID 101183893) is phenyl 2,2-difluoro-2-methylsulfanylacetate.
What is the SMILES notation for phenyl 2,2-difluoro-2-methylsulfanylacetate?
The canonical SMILES for phenyl 2,2-difluoro-2-methylsulfanylacetate is CSC(F)(F)C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2,2-difluoro-2-methylsulfanylacetate?
The InChIKey is XNAVSMIWKKIKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O2S/c1-14-9(10,11)8(12)13-7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of phenyl 2,2-difluoro-2-methylsulfanylacetate?
phenyl 2,2-difluoro-2-methylsulfanylacetate has a molecular weight of 218.22 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2,2-difluoro-2-methylsulfanylacetate is sourced from PubChem (CID 101183893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).