C10H5F4O4- — CID 164747391
2,2,3,3-tetrafluoro-4-oxo-4-phenoxybutanoate (PubChem CID 164747391) has the molecular formula C10H5F4O4- and a molecular weight of 265.14 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-oxo-4-phenoxybutanoate.
| Compound Name | 2,2,3,3-tetrafluoro-4-oxo-4-phenoxybutanoate |
|---|---|
| PubChem CID | 164747391 |
| Molecular Formula | C10H5F4O4- |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-oxo-4-phenoxybutanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C10H6F4O4/c11-9(12,7(15)16)10(13,14)8(17)18-6-4-2-1-3-5-6/h1-5H,(H,15,16)/p-1 |
| InChIKey | LJHMULOTHHDDRI-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|