C18H21F4O4- — CID 164746584
4-(2,6-ditert-butylphenoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate (PubChem CID 164746584) has the molecular formula C18H21F4O4- and a molecular weight of 377.35 g/mol. Its IUPAC name is 4-(2,6-ditert-butylphenoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate.
| Compound Name | 4-(2,6-ditert-butylphenoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate |
|---|---|
| PubChem CID | 164746584 |
| Molecular Formula | C18H21F4O4- |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-(2,6-ditert-butylphenoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OC(=O)C(F)(F)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C18H22F4O4/c1-15(2,3)10-8-7-9-11(16(4,5)6)12(10)26-14(25)18(21,22)17(19,20)13(23)24/h7-9H,1-6H3,(H,23,24)/p-1 |
| InChIKey | ZAINRUSPWVHFMN-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|