C12H5F4I2O6- — CID 164746899
4-(2,4-diiodo-6-methoxycarbonylphenoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate (PubChem CID 164746899) has the molecular formula C12H5F4I2O6- and a molecular weight of 574.97 g/mol. Its IUPAC name is 4-(2,4-diiodo-6-methoxycarbonylphenoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate.
| Compound Name | 4-(2,4-diiodo-6-methoxycarbonylphenoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate |
|---|---|
| PubChem CID | 164746899 |
| Molecular Formula | C12H5F4I2O6- |
| Molecular Weight | 574.97 g/mol |
| Exact Mass | 574.81 |
| IUPAC Name | 4-(2,4-diiodo-6-methoxycarbonylphenoxy)-2,2,3,3-tetrafluoro-4-oxobutanoate |
| SMILES | COC(=O)c1cc(I)cc(I)c1OC(=O)C(F)(F)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C12H6F4I2O6/c1-23-8(19)5-2-4(17)3-6(18)7(5)24-10(22)12(15,16)11(13,14)9(20)21/h2-3H,1H3,(H,20,21)/p-1 |
| InChIKey | IJISXCRVOIVRTJ-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.97 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|