C8H5I2O3- — CID 21272597
3,5-diiodo-2-methoxybenzoate (PubChem CID 21272597) has the molecular formula C8H5I2O3- and a molecular weight of 402.93 g/mol. Its IUPAC name is 3,5-diiodo-2-methoxybenzoate.
| Compound Name | 3,5-diiodo-2-methoxybenzoate |
|---|---|
| PubChem CID | 21272597 |
| Molecular Formula | C8H5I2O3- |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.83 |
| IUPAC Name | 3,5-diiodo-2-methoxybenzoate |
| SMILES | COc1c(I)cc(I)cc1C(=O)[O-] |
| InChI | InChI=1S/C8H6I2O3/c1-13-7-5(8(11)12)2-4(9)3-6(7)10/h2-3H,1H3,(H,11,12)/p-1 |
| InChIKey | HLZOAFKJWZBDPO-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|