C11H7I2O6S- — CID 168744725
3,5-diiodo-2-[2-(2-sulfanylacetyl)oxyacetyl]oxybenzoate (PubChem CID 168744725) has the molecular formula C11H7I2O6S- and a molecular weight of 521.05 g/mol. Its IUPAC name is 3,5-diiodo-2-[2-(2-sulfanylacetyl)oxyacetyl]oxybenzoate.
| Compound Name | 3,5-diiodo-2-[2-(2-sulfanylacetyl)oxyacetyl]oxybenzoate |
|---|---|
| PubChem CID | 168744725 |
| Molecular Formula | C11H7I2O6S- |
| Molecular Weight | 521.05 g/mol |
| Exact Mass | 520.81 |
| IUPAC Name | 3,5-diiodo-2-[2-(2-sulfanylacetyl)oxyacetyl]oxybenzoate |
| SMILES | O=C(CS)OCC(=O)Oc1c(I)cc(I)cc1C(=O)[O-] |
| InChI | InChI=1S/C11H8I2O6S/c12-5-1-6(11(16)17)10(7(13)2-5)19-8(14)3-18-9(15)4-20/h1-2,20H,3-4H2,(H,16,17)/p-1 |
| InChIKey | SEVJEJVBVBWDKW-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.05 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|