C9H9I2NO2 — CID 132591548
2-ethoxy-3,5-diiodobenzamide (PubChem CID 132591548) has the molecular formula C9H9I2NO2 and a molecular weight of 416.98 g/mol. Its IUPAC name is 2-ethoxy-3,5-diiodobenzamide.
| Compound Name | 2-ethoxy-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 132591548 |
| Molecular Formula | C9H9I2NO2 |
| Molecular Weight | 416.98 g/mol |
| Exact Mass | 416.87 |
| IUPAC Name | 2-ethoxy-3,5-diiodobenzamide |
| SMILES | CCOc1c(I)cc(I)cc1C(N)=O |
| InChI | InChI=1S/C9H9I2NO2/c1-2-14-8-6(9(12)13)3-5(10)4-7(8)11/h3-4H,2H2,1H3,(H2,12,13) |
| InChIKey | MBCJIBFIRQPYAU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.98 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|