C9H9I2NO3 — CID 60717182
N-ethoxy-2-hydroxy-3,5-diiodobenzamide (PubChem CID 60717182) has the molecular formula C9H9I2NO3 and a molecular weight of 432.98 g/mol. Its IUPAC name is N-ethoxy-2-hydroxy-3,5-diiodobenzamide.
| Compound Name | N-ethoxy-2-hydroxy-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 60717182 |
| Molecular Formula | C9H9I2NO3 |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.87 |
| IUPAC Name | N-ethoxy-2-hydroxy-3,5-diiodobenzamide |
| SMILES | CCONC(=O)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C9H9I2NO3/c1-2-15-12-9(14)6-3-5(10)4-7(11)8(6)13/h3-4,13H,2H2,1H3,(H,12,14) |
| InChIKey | SDIIEKMKYDLECP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|