C11H13I2NO3 — CID 93041920
2-hydroxy-N-[(2S)-1-hydroxybutan-2-yl]-3,5-diiodobenzamide (PubChem CID 93041920) has the molecular formula C11H13I2NO3 and a molecular weight of 461.04 g/mol. Its IUPAC name is 2-hydroxy-N-[(2S)-1-hydroxybutan-2-yl]-3,5-diiodobenzamide.
| Compound Name | 2-hydroxy-N-[(2S)-1-hydroxybutan-2-yl]-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 93041920 |
| Molecular Formula | C11H13I2NO3 |
| Molecular Weight | 461.04 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | 2-hydroxy-N-[(2S)-1-hydroxybutan-2-yl]-3,5-diiodobenzamide |
| SMILES | CC[C@@H](CO)NC(=O)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C11H13I2NO3/c1-2-7(5-15)14-11(17)8-3-6(12)4-9(13)10(8)16/h3-4,7,15-16H,2,5H2,1H3,(H,14,17)/t7-/m0/s1 |
| InChIKey | XYWRJBFJEBIDMK-ZETCQYMHSA-N |
| XLogP | 2.10 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.04 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|