C11H13Br2NO2 — CID 114371947
2,5-dibromo-N-(1-hydroxybutan-2-yl)benzamide (PubChem CID 114371947) has the molecular formula C11H13Br2NO2 and a molecular weight of 351.04 g/mol. Its IUPAC name is 2,5-dibromo-N-(1-hydroxybutan-2-yl)benzamide.
| Compound Name | 2,5-dibromo-N-(1-hydroxybutan-2-yl)benzamide |
|---|---|
| PubChem CID | 114371947 |
| Molecular Formula | C11H13Br2NO2 |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | 2,5-dibromo-N-(1-hydroxybutan-2-yl)benzamide |
| SMILES | CCC(CO)NC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H13Br2NO2/c1-2-8(6-15)14-11(16)9-5-7(12)3-4-10(9)13/h3-5,8,15H,2,6H2,1H3,(H,14,16) |
| InChIKey | XTIDPXBGNUSDQV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |