C10H12BrClN2O2 — CID 103919732
5-bromo-2-chloro-N-[(2R)-1-hydroxybutan-2-yl]pyridine-3-carboxamide (PubChem CID 103919732) has the molecular formula C10H12BrClN2O2 and a molecular weight of 307.58 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(2R)-1-hydroxybutan-2-yl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-[(2R)-1-hydroxybutan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103919732 |
| Molecular Formula | C10H12BrClN2O2 |
| Molecular Weight | 307.58 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 5-bromo-2-chloro-N-[(2R)-1-hydroxybutan-2-yl]pyridine-3-carboxamide |
| SMILES | CC[C@H](CO)NC(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C10H12BrClN2O2/c1-2-7(5-15)14-10(16)8-3-6(11)4-13-9(8)12/h3-4,7,15H,2,5H2,1H3,(H,14,16)/t7-/m1/s1 |
| InChIKey | VNVFFJFNUDHQPH-SSDOTTSWSA-N |
| XLogP | 2.00 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.58 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|