C13H19BrClN3O — CID 62000473
5-bromo-2-chloro-N-[1-(dimethylamino)-3-methylbutan-2-yl]pyridine-3-carboxamide (PubChem CID 62000473) has the molecular formula C13H19BrClN3O and a molecular weight of 348.67 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[1-(dimethylamino)-3-methylbutan-2-yl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-[1-(dimethylamino)-3-methylbutan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62000473 |
| Molecular Formula | C13H19BrClN3O |
| Molecular Weight | 348.67 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 5-bromo-2-chloro-N-[1-(dimethylamino)-3-methylbutan-2-yl]pyridine-3-carboxamide |
| SMILES | CC(C)C(CN(C)C)NC(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C13H19BrClN3O/c1-8(2)11(7-18(3)4)17-13(19)10-5-9(14)6-16-12(10)15/h5-6,8,11H,7H2,1-4H3,(H,17,19) |
| InChIKey | HLBJTUUMTSOGMR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.67 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|