C10H12BrClN2OS — CID 115759495
5-bromo-2-chloro-N-(2-methylsulfanylpropyl)pyridine-3-carboxamide (PubChem CID 115759495) has the molecular formula C10H12BrClN2OS and a molecular weight of 323.64 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2-methylsulfanylpropyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-(2-methylsulfanylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115759495 |
| Molecular Formula | C10H12BrClN2OS |
| Molecular Weight | 323.64 g/mol |
| Exact Mass | 321.95 |
| IUPAC Name | 5-bromo-2-chloro-N-(2-methylsulfanylpropyl)pyridine-3-carboxamide |
| SMILES | CSC(C)CNC(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C10H12BrClN2OS/c1-6(16-2)4-14-10(15)8-3-7(11)5-13-9(8)12/h3,5-6H,4H2,1-2H3,(H,14,15) |
| InChIKey | SCLNGBGZJWRWHN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.64 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|