C12H12BrClN4OS — CID 71861931
5-bromo-2-chloro-N-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]pyridine-3-carboxamide (PubChem CID 71861931) has the molecular formula C12H12BrClN4OS and a molecular weight of 375.68 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71861931 |
| Molecular Formula | C12H12BrClN4OS |
| Molecular Weight | 375.68 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 5-bromo-2-chloro-N-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]pyridine-3-carboxamide |
| SMILES | CC(C)c1nnc(CNC(=O)c2cc(Br)cnc2Cl)s1 |
| InChI | InChI=1S/C12H12BrClN4OS/c1-6(2)12-18-17-9(20-12)5-16-11(19)8-3-7(13)4-15-10(8)14/h3-4,6H,5H2,1-2H3,(H,16,19) |
| InChIKey | HNUSQUYJIVVUIC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|