C14H19ClN4OS — CID 120635768
5-amino-2-methyl-N-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]benzamide;hydrochloride (PubChem CID 120635768) has the molecular formula C14H19ClN4OS and a molecular weight of 326.85 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]benzamide;hydrochloride.
| Compound Name | 5-amino-2-methyl-N-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120635768 |
| Molecular Formula | C14H19ClN4OS |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 5-amino-2-methyl-N-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NCc1nnc(C(C)C)s1.Cl |
| InChI | InChI=1S/C14H18N4OS.ClH/c1-8(2)14-18-17-12(20-14)7-16-13(19)11-6-10(15)5-4-9(11)3;/h4-6,8H,7,15H2,1-3H3,(H,16,19);1H |
| InChIKey | DYKFAOGHOZMLJK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|