C22H30N6O4 — CID 91141603
5-amino-N-(3-amino-3-oxopropyl)-2-methylbenzamide (PubChem CID 91141603) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 5-amino-N-(3-amino-3-oxopropyl)-2-methylbenzamide.
| Compound Name | 5-amino-N-(3-amino-3-oxopropyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 91141603 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 5-amino-N-(3-amino-3-oxopropyl)-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NCCC(N)=O.Cc1ccc(N)cc1C(=O)NCCC(N)=O |
| InChI | InChI=1S/2C11H15N3O2/c2*1-7-2-3-8(12)6-9(7)11(16)14-5-4-10(13)15/h2*2-3,6H,4-5,12H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | MODXECVGMKPVGJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 196.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|