C9H11N3O2 — CID 130015000
5-amino-N-carbamoyl-2-methylbenzamide (PubChem CID 130015000) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 5-amino-N-carbamoyl-2-methylbenzamide.
| Compound Name | 5-amino-N-carbamoyl-2-methylbenzamide |
|---|---|
| PubChem CID | 130015000 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 5-amino-N-carbamoyl-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NC(N)=O |
| InChI | InChI=1S/C9H11N3O2/c1-5-2-3-6(10)4-7(5)8(13)12-9(11)14/h2-4H,10H2,1H3,(H3,11,12,13,14) |
| InChIKey | KVCDHCNDRZPAJX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|