C16H21N2OP — CID 177145288
5-amino-2-methyl-N-[(3E,5Z)-5-methyl-3-phosphanylhepta-1,3,5-trien-2-yl]benzamide (PubChem CID 177145288) has the molecular formula C16H21N2OP and a molecular weight of 288.33 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[(3E,5Z)-5-methyl-3-phosphanylhepta-1,3,5-trien-2-yl]benzamide.
| Compound Name | 5-amino-2-methyl-N-[(3E,5Z)-5-methyl-3-phosphanylhepta-1,3,5-trien-2-yl]benzamide |
|---|---|
| PubChem CID | 177145288 |
| Molecular Formula | C16H21N2OP |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5-amino-2-methyl-N-[(3E,5Z)-5-methyl-3-phosphanylhepta-1,3,5-trien-2-yl]benzamide |
| SMILES | C=C(NC(=O)c1cc(N)ccc1C)/C(P)=C\C(C)=C/C |
| InChI | InChI=1S/C16H21N2OP/c1-5-10(2)8-15(20)12(4)18-16(19)14-9-13(17)7-6-11(14)3/h5-9H,4,17,20H2,1-3H3,(H,18,19)/b10-5-,15-8+ |
| InChIKey | MZPWRCJNVVJLLL-XKEXRUKZSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|