C16H16N2O3 — CID 63115622
5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid (PubChem CID 63115622) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid.
| Compound Name | 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 63115622 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid |
| SMILES | Cc1ccc(C)c(C(=O)Nc2ccc(N)cc2C(=O)O)c1 |
| InChI | InChI=1S/C16H16N2O3/c1-9-3-4-10(2)12(7-9)15(19)18-14-6-5-11(17)8-13(14)16(20)21/h3-8H,17H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | MYUJLIUWRQFFTC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|