5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid

C16H16N2O3 — CID 63115622

IUPAC5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid
SMILESCc1ccc(C)c(C(=O)Nc2ccc(N)cc2C(=O)O)c1
InChIInChI=1S/C16H16N2O3/c1-9-3-4-10(2)12(7-9)15(19)18-14-6-5-11(17)8-13(14)16(20)21/h3-8H,17H2,1-2H3,(H,18,19)(H,20,21)
InChIKeyMYUJLIUWRQFFTC-UHFFFAOYSA-N
MW284.32 g/mol
LogP2.84
Rot. Bonds3

About 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid

5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid (PubChem CID 63115622) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid
PubChem CID63115622
Molecular FormulaC16H16N2O3
Molecular Weight284.32 g/mol
Exact Mass284.12
IUPAC Name5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid
SMILESCc1ccc(C)c(C(=O)Nc2ccc(N)cc2C(=O)O)c1
InChIInChI=1S/C16H16N2O3/c1-9-3-4-10(2)12(7-9)15(19)18-14-6-5-11(17)8-13(14)16(20)21/h3-8H,17H2,1-2H3,(H,18,19)(H,20,21)
InChIKeyMYUJLIUWRQFFTC-UHFFFAOYSA-N
XLogP2.84
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.32
LogP ≤ 52.84
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid?
The IUPAC name of 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid (CID 63115622) is 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid.
What is the SMILES notation for 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid?
The canonical SMILES for 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid is Cc1ccc(C)c(C(=O)Nc2ccc(N)cc2C(=O)O)c1.
What is the InChIKey of 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid?
The InChIKey is MYUJLIUWRQFFTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-9-3-4-10(2)12(7-9)15(19)18-14-6-5-11(17)8-13(14)16(20)21/h3-8H,17H2,1-2H3,(H,18,19)(H,20,21).
What are the key properties of 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid?
5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid has a molecular weight of 284.32 g/mol, XLogP of 2.84, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[(2,5-dimethylbenzoyl)amino]benzoic acid is sourced from PubChem (CID 63115622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).