C11H16N4O2 — CID 83108050
4-amino-N-[2-(carbamoylamino)ethyl]-2-methylbenzamide (PubChem CID 83108050) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 4-amino-N-[2-(carbamoylamino)ethyl]-2-methylbenzamide.
| Compound Name | 4-amino-N-[2-(carbamoylamino)ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 83108050 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-amino-N-[2-(carbamoylamino)ethyl]-2-methylbenzamide |
| SMILES | Cc1cc(N)ccc1C(=O)NCCNC(N)=O |
| InChI | InChI=1S/C11H16N4O2/c1-7-6-8(12)2-3-9(7)10(16)14-4-5-15-11(13)17/h2-3,6H,4-5,12H2,1H3,(H,14,16)(H3,13,15,17) |
| InChIKey | NZHIFQHPTFFCBU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|