C10H13FN4O2 — CID 83120721
2-amino-N-[2-(carbamoylamino)ethyl]-4-fluorobenzamide (PubChem CID 83120721) has the molecular formula C10H13FN4O2 and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-amino-N-[2-(carbamoylamino)ethyl]-4-fluorobenzamide.
| Compound Name | 2-amino-N-[2-(carbamoylamino)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 83120721 |
| Molecular Formula | C10H13FN4O2 |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-amino-N-[2-(carbamoylamino)ethyl]-4-fluorobenzamide |
| SMILES | NC(=O)NCCNC(=O)c1ccc(F)cc1N |
| InChI | InChI=1S/C10H13FN4O2/c11-6-1-2-7(8(12)5-6)9(16)14-3-4-15-10(13)17/h1-2,5H,3-4,12H2,(H,14,16)(H3,13,15,17) |
| InChIKey | GXPRUGMHLDLKHV-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|