C10H14FN3O3S — CID 63110426
2-amino-4-fluoro-N-(3-sulfamoylpropyl)benzamide (PubChem CID 63110426) has the molecular formula C10H14FN3O3S and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-(3-sulfamoylpropyl)benzamide.
| Compound Name | 2-amino-4-fluoro-N-(3-sulfamoylpropyl)benzamide |
|---|---|
| PubChem CID | 63110426 |
| Molecular Formula | C10H14FN3O3S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-amino-4-fluoro-N-(3-sulfamoylpropyl)benzamide |
| SMILES | Nc1cc(F)ccc1C(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C10H14FN3O3S/c11-7-2-3-8(9(12)6-7)10(15)14-4-1-5-18(13,16)17/h2-3,6H,1,4-5,12H2,(H,14,15)(H2,13,16,17) |
| InChIKey | QHVRDVTWGPMZMA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|