C10H11F3N2O3S — CID 65100894
2,4,6-trifluoro-N-(3-sulfamoylpropyl)benzamide (PubChem CID 65100894) has the molecular formula C10H11F3N2O3S and a molecular weight of 296.27 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-(3-sulfamoylpropyl)benzamide.
| Compound Name | 2,4,6-trifluoro-N-(3-sulfamoylpropyl)benzamide |
|---|---|
| PubChem CID | 65100894 |
| Molecular Formula | C10H11F3N2O3S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2,4,6-trifluoro-N-(3-sulfamoylpropyl)benzamide |
| SMILES | NS(=O)(=O)CCCNC(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H11F3N2O3S/c11-6-4-7(12)9(8(13)5-6)10(16)15-2-1-3-19(14,17)18/h4-5H,1-3H2,(H,15,16)(H2,14,17,18) |
| InChIKey | QXRQNYPOMCOKAT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|