C9H13N3O3S — CID 47337075
N-(3-sulfamoylpropyl)pyridine-4-carboxamide (PubChem CID 47337075) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is N-(3-sulfamoylpropyl)pyridine-4-carboxamide.
| Compound Name | N-(3-sulfamoylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 47337075 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-(3-sulfamoylpropyl)pyridine-4-carboxamide |
| SMILES | NS(=O)(=O)CCCNC(=O)c1ccncc1 |
| InChI | InChI=1S/C9H13N3O3S/c10-16(14,15)7-1-4-12-9(13)8-2-5-11-6-3-8/h2-3,5-6H,1,4,7H2,(H,12,13)(H2,10,14,15) |
| InChIKey | VCEJLMZMWJFNRI-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|