C9H12N2O4S — CID 43552549
4-hydroxy-N-(2-sulfamoylethyl)benzamide (PubChem CID 43552549) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 4-hydroxy-N-(2-sulfamoylethyl)benzamide.
| Compound Name | 4-hydroxy-N-(2-sulfamoylethyl)benzamide |
|---|---|
| PubChem CID | 43552549 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 4-hydroxy-N-(2-sulfamoylethyl)benzamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H12N2O4S/c10-16(14,15)6-5-11-9(13)7-1-3-8(12)4-2-7/h1-4,12H,5-6H2,(H,11,13)(H2,10,14,15) |
| InChIKey | CUYUPTUXBZNDJZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |